CAS 915916-58-4

4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline

Description:

4-Methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline is an organic compound characterized by its complex structure, which includes an aniline moiety substituted with a methyl group and a pyridine-linked oxadiazole. This compound features a 1,3,4-oxadiazole ring, which is known for its heterocyclic properties and potential biological activity. The presence of the pyridine ring contributes to its aromatic character and may influence its solubility and reactivity. Typically, compounds like this can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's properties, such as melting point, solubility, and stability, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₄H₁₂N₄O

InChI: InChI=1/C14H12N4O/c1-9-2-3-12(15)11(8-9)14-18-17-13(19-14)10-4-6-16-7-5-10/h2-8H,15H2,1H3

SMILES: Cc1ccc(c(c1)c1nnc(c2ccncc2)o1)N

Synonyms:

• Benzenamine, 4-Methyl-2-[5-(4-Pyridinyl)-1,3,4-Oxadiazol-2-Yl]-

4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline

CAS: 915916-58-4

Purity: 95.0%

Molecular weight: 252.27699279785156

Ref: 10-F315784