CAS 915917-10-1

1-[1-(2-methoxyethyl)indol-3-yl]ethanone

Description:

1-[1-(2-methoxyethyl)indol-3-yl]ethanone, with the CAS number 915917-10-1, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a ketone functional group (ethanone) and a methoxyethyl substituent, which contributes to its unique chemical properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. The indole moiety is known for its role in various biological systems and can exhibit diverse pharmacological effects. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, its synthesis and characterization would typically involve standard organic reactions, including alkylation and acylation processes. Overall, this compound represents a class of indole derivatives that may possess interesting chemical and biological properties, warranting further investigation in research and development contexts.

Formula: C₁₃H₁₅NO₂

InChI: InChI=1/C13H15NO2/c1-10(15)12-9-14(7-8-16-2)13-6-4-3-5-11(12)13/h3-6,9H,7-8H2,1-2H3

SMILES: CC(=O)c1cn(CCOC)c2ccccc12

1-(1-(2-Methoxyethyl)-1H-indol-3-yl)ethanone

CAS: 915917-10-1

Formula: C₁₃H₁₅NO₂

Molecular weight: 217.2637

Ref: IN-DA006TGZ

1-[1-(2-methoxyethyl)-1H-indol-3-yl]ethanone

CAS: 915917-10-1

Formula: C₁₃H₁₅NO₂

Purity: 95.0%

Molecular weight: 217.268

Ref: 10-F315648

1-[1-(2-Methoxyethyl)-1H-indol-3-yl]ethanone

Controlled Product

CAS: 915917-10-1

Please enquire for more information about 1-[1-(2-Methoxyethyl)-1H-indol-3-yl]ethanone including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₅NO₂

Purity: Min. 95%

Molecular weight: 217.26 g/mol

Ref: 3D-QLB91710