CAS 915919-64-1

[1-(3-aminopropyl)piperidin-2-yl]methanol

Description:

[1-(3-aminopropyl)piperidin-2-yl]methanol, with the CAS number 915919-64-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an amino group attached to a propyl chain, contributing to its potential biological activity. The presence of the hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that can interact with biological targets. Its molecular structure suggests potential applications in areas such as neuropharmacology or as a building block for more complex molecules. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies. As with many amines, it may also exhibit basicity, influencing its reactivity and interactions in various chemical environments.

Formula: C₉H₂₀N₂O

InChI: InChI=1/C9H20N2O/c10-5-3-7-11-6-2-1-4-9(11)8-12/h9,12H,1-8,10H2

SMILES: C1CCN(CCCN)C(C1)CO

[1-(3-aminopropyl)piperidin-2-yl]methanol

CAS: 915919-64-1

Formula: C₉H₂₀N₂O

Purity: 95.0%

Molecular weight: 172.272

Ref: 10-F308983