CymitQuimica logo

CAS 915919-65-2

:

2-(4,7-dimethyl-2-oxo-indolin-3-yl)acetic acid

Description:
2-(4,7-Dimethyl-2-oxo-indolin-3-yl)acetic acid, identified by its CAS number 915919-65-2, is a chemical compound that features an indoline structure with a carboxylic acid functional group. This compound is characterized by its unique bicyclic framework, which includes a ketone and an acetic acid moiety. The presence of two methyl groups at the 4 and 7 positions contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The indoline core is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Its structural features may allow for interactions with various biological targets, and it may exhibit properties such as anti-inflammatory or anticancer activities, although specific biological data would be necessary to confirm these effects. Overall, 2-(4,7-dimethyl-2-oxo-indolin-3-yl)acetic acid represents a compound with potential applications in pharmaceuticals, driven by its unique chemical structure and functional groups.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-6-3-4-7(2)11-10(6)8(5-9(14)15)12(16)13-11/h3-4,8H,5H2,1-2H3,(H,13,16)(H,14,15)
SMILES:Cc1ccc(C)c2c1C(CC(=O)O)C(=N2)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.