CymitQuimica logo

CAS 915919-81-2

:

1-(3-methyl-4-pyridyl)-1,4-diazepane

Description:
1-(3-Methyl-4-pyridyl)-1,4-diazepane, identified by its CAS number 915919-81-2, is a chemical compound characterized by its unique structure that includes a diazepane ring and a pyridine moiety. The diazepane portion consists of a seven-membered ring containing two nitrogen atoms, which contributes to its potential biological activity. The presence of the 3-methyl-4-pyridyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically studied for its pharmacological properties, particularly in the context of neuropharmacology, where it may exhibit effects on neurotransmitter systems. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Overall, 1-(3-methyl-4-pyridyl)-1,4-diazepane represents a class of compounds with potential therapeutic applications, warranting further investigation into its properties and effects.
Formula:C11H17N3
InChI:InChI=1/C11H17N3/c1-10-9-13-5-3-11(10)14-7-2-4-12-6-8-14/h3,5,9,12H,2,4,6-8H2,1H3
SMILES:Cc1cnccc1N1CCCNCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.