CAS 915919-82-3

1-Ethyl-6-oxo-3-piperidinecarboxylic acid

Description:

1-Ethyl-6-oxo-3-piperidinecarboxylic acid, with the CAS number 915919-82-3, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered ring containing one nitrogen atom, and is substituted with an ethyl group and a carboxylic acid functional group. The presence of the keto group (6-oxo) indicates that there is a carbonyl functional group (C=O) at the sixth position of the piperidine ring. This compound is likely to exhibit properties typical of both carboxylic acids and piperidine derivatives, such as potential acidity due to the carboxylic acid group and basicity from the nitrogen atom in the piperidine ring. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with piperidine derivatives. However, specific physical and chemical properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₈H₁₃NO₃

InChI: InChI=1/C8H13NO3/c1-2-9-5-6(8(11)12)3-4-7(9)10/h6H,2-5H2,1H3,(H,11,12)

InChI key: InChIKey=BDOVKBMNIWNGIL-UHFFFAOYSA-N

SMILES: C(C)N1CC(C(O)=O)CCC1=O

Synonyms:

• 3-Piperidinecarboxylic acid, 1-ethyl-6-oxo-
• 1-Ethyl-6-oxo-3-piperidinecarboxylic acid
• CHEMBRDG-BB 4015794
• 1-ethyl-6-oxopiperidine-3-carboxylic acid(SALTDATA: FREE)
• 1-ETHYL-6-OXOPIPERIDINE-3-CARBOXYLIC ACID

1-Ethyl-6-oxo-3-piperidinecarboxylic Acid

Controlled Product

CAS: 915919-82-3

Applications 1-ethyl-6-oxopiperidine-3-carboxylic acid (cas# 915919-82-3) is a useful research chemical.

Formula: C₈H₁₃NO₃

Color and Shape: Neat

Molecular weight: 171.19

Ref: TR-B440660

1-Ethyl-6-oxopiperidine-3-carboxylic acid

CAS: 915919-82-3

Versatile small molecule scaffold

Formula: C₈H₁₃NO₃

Purity: Min. 95%

Molecular weight: 171.19 g/mol

Ref: 3D-QLB91982