CAS 915919-83-4
:N-[(2-Fluorophenyl)methyl]-N-methylguanidine
Description:
N-[(2-Fluorophenyl)methyl]-N-methylguanidine is a chemical compound characterized by its guanidine structure, which features a methyl group and a 2-fluorophenylmethyl substituent. This compound typically exhibits properties associated with guanidine derivatives, such as potential basicity due to the presence of nitrogen atoms that can donate electron pairs. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its specific applications and biological activity would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Safety and handling considerations are essential, as with any chemical substance, and should be guided by material safety data sheets (MSDS) and relevant regulations.
Formula:C9H12FN3
InChI:InChI=1S/C9H12FN3/c1-13(9(11)12)6-7-4-2-3-5-8(7)10/h2-5H,6H2,1H3,(H3,11,12)
InChI key:InChIKey=JKCKUYIRDQWKDU-UHFFFAOYSA-N
SMILES:C(N(C(=N)N)C)C1=C(F)C=CC=C1
Synonyms:- N-[(2-Fluorophenyl)methyl]-N-methylguanidine
- Guanidine, N-[(2-fluorophenyl)methyl]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.