CymitQuimica logo

CAS 915919-97-0

:

[1-(2-methoxyethyl)-4-piperidyl]methanol

Description:
[1-(2-methoxyethyl)-4-piperidyl]methanol, with the CAS number 915919-97-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methanol group and a 2-methoxyethyl substituent, contributing to its solubility and potential interactions in biological systems. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the methoxy group enhances its lipophilicity, which may influence its pharmacokinetic properties, such as absorption and distribution in biological tissues. Additionally, the piperidine moiety is often associated with various biological activities, making this compound of interest in medicinal chemistry. Its specific applications and effects would depend on further research, particularly in the context of its interactions with biological targets. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H19NO2
InChI:InChI=1/C9H19NO2/c1-12-7-6-10-4-2-9(8-11)3-5-10/h9,11H,2-8H2,1H3
SMILES:COCCN1CCC(CC1)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.