CymitQuimica logo

CAS 915920-01-3

:

3-(2-methoxyethyl)-5-(3-piperidyl)-1,2,4-oxadiazole

Description:
3-(2-Methoxyethyl)-5-(3-piperidyl)-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methoxyethyl group and a piperidyl substituent, contributing to its potential biological activity. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The oxadiazole framework is known for its diverse applications, including use in pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions and interactions. The compound's solubility, stability, and reactivity can be influenced by the substituents on the oxadiazole ring, which can affect its pharmacokinetic properties. Overall, 3-(2-methoxyethyl)-5-(3-piperidyl)-1,2,4-oxadiazole represents a class of compounds that may exhibit significant biological activity, warranting further investigation in drug development and related fields.
Formula:C10H17N3O2
InChI:InChI=1/C10H17N3O2/c1-14-6-4-9-12-10(15-13-9)8-3-2-5-11-7-8/h8,11H,2-7H2,1H3
SMILES:COCCc1nc(C2CCCNC2)on1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.