
CAS 915920-02-4
:5-Ethyl-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine
Description:
5-Ethyl-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of an ethyl group and an isopropyl substituent on the nitrogen atom enhances its lipophilicity, potentially influencing its interaction with biological membranes. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in pharmaceutical research. Its molecular structure includes functional groups that can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The oxadiazole moiety is known for its stability and ability to form hydrogen bonds, which can be crucial for its reactivity and interactions with other molecules. Additionally, the compound's solubility, melting point, and stability under different conditions would be important characteristics to consider for practical applications. Overall, 5-Ethyl-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine represents a class of compounds that may have significant implications in medicinal chemistry and material science.
Formula:C8H15N3O
InChI:InChI=1S/C8H15N3O/c1-4-7-10-11-8(12-7)5-9-6(2)3/h6,9H,4-5H2,1-3H3
InChI key:InChIKey=BBJQHAJAIIFZFI-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1OC(CC)=NN1
Synonyms:- N-[(5-Ethyl-1,3,4-oxadiazol-2-yl)methyl]propan-2-amine
- 1,3,4-Oxadiazole-2-methanamine, 5-ethyl-N-(1-methylethyl)-
- 5-Ethyl-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.