CAS 915920-03-5

(5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanol

Description:

(5-Cyclopentyl-1,2,4-oxadiazol-3-yl)methanol is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the cyclopentyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The hydroxymethyl group (-CH2OH) attached to the oxadiazole ring may impart polar characteristics, allowing for hydrogen bonding and solubility in polar solvents. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The CAS number 915920-03-5 serves as a unique identifier for this compound, facilitating its identification in chemical databases and literature. Overall, (5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanol represents a class of compounds that could be explored for various therapeutic applications, pending further investigation into its biological properties and mechanisms of action.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1/C8H12N2O2/c11-5-7-9-8(12-10-7)6-3-1-2-4-6/h6,11H,1-5H2

SMILES: C1CCC(C1)c1nc(CO)no1

(5-cyclopentyl-1,2,4-oxadiazol-3-yl)methanol

CAS: 915920-03-5

Formula: C₈H₁₂N₂O₂

Purity: 95.0%

Molecular weight: 168.196

Ref: 10-F309750