CAS 915920-09-1

3-[(Methylthio)methyl]-1,2,4-oxadiazole-5-methanamine

Description:

3-[(Methylthio)methyl]-1,2,4-oxadiazole-5-methanamine, identified by its CAS number 915920-09-1, is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. This compound features a methylthio group, which can enhance its lipophilicity and influence its interaction with biological targets. The presence of the methanamine moiety suggests potential for hydrogen bonding, which may play a role in its reactivity and solubility in various solvents. Typically, compounds of this nature are investigated for their pharmacological properties, including antimicrobial or anticancer activities, due to the presence of heteroatoms in the ring structure that can participate in various chemical reactions. Additionally, the stability of the oxadiazole ring under different conditions is an important characteristic that can affect its application in medicinal chemistry. Overall, the specific properties and reactivity of this compound would depend on its molecular interactions and the environment in which it is studied.

Formula: C₅H₉N₃OS

InChI: InChI=1S/C5H9N3OS/c1-10-3-4-7-5(2-6)9-8-4/h2-3,6H2,1H3

InChI key: InChIKey=FEDGAUALEORIEY-UHFFFAOYSA-N

SMILES: C(SC)C=1N=C(CN)ON1

Synonyms:

• 3-[(Methylthio)methyl]-1,2,4-oxadiazole-5-methanamine
• 1,2,4-Oxadiazole-5-methanamine, 3-[(methylthio)methyl]-