CAS 915920-11-5

2-[(5-fluoro-1H-benzimidazol-2-yl)methoxy]acetic acid

Description:

2-[(5-fluoro-1H-benzimidazol-2-yl)methoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety substituted with a fluorine atom and a methoxy group linked to an acetic acid functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The fluorine substitution on the benzimidazole ring may enhance its biological activity and lipophilicity, potentially influencing its pharmacokinetic properties. The compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, possibly in the treatment of various diseases. Its molecular interactions can be studied through various analytical techniques, including NMR and mass spectrometry, to elucidate its behavior in biological systems. Overall, 2-[(5-fluoro-1H-benzimidazol-2-yl)methoxy]acetic acid represents a significant compound for research in drug development and related fields.

Formula: C₁₀H₉FN₂O₃

InChI: InChI=1/C10H9FN2O3/c11-6-1-2-7-8(3-6)13-9(12-7)4-16-5-10(14)15/h1-3H,4-5H2,(H,12,13)(H,14,15)

SMILES: c1cc2c(cc1F)[nH]c(COCC(=O)O)n2

Synonyms:

• [(5-fluoro-1H-benzimidazol-2-yl)methoxy]acetic acid
• acetic acid, 2-[(5-fluoro-1H-benzimidazol-2-yl)methoxy]-