CAS 915920-13-7

2-(Butylthio)-5-pyrimidinecarboxaldehyde

Description:

2-(Butylthio)-5-pyrimidinecarboxaldehyde is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a butylthio group indicates that a butyl chain is attached to a sulfur atom, which is further connected to the pyrimidine ring. This compound features an aldehyde functional group (-CHO) at the 5-position of the pyrimidine, contributing to its reactivity and potential applications in organic synthesis. The butylthio group enhances the compound's lipophilicity, which may influence its solubility and interaction with biological systems. Additionally, the compound may exhibit various chemical properties such as reactivity towards nucleophiles due to the electrophilic nature of the aldehyde group. Its unique structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.

Formula: C₉H₁₂N₂OS

InChI: InChI=1S/C9H12N2OS/c1-2-3-4-13-9-10-5-8(7-12)6-11-9/h5-7H,2-4H2,1H3

InChI key: InChIKey=YCJOTWCAJTZPNS-UHFFFAOYSA-N

SMILES: S(CCCC)C=1N=CC(C=O)=CN1

Synonyms:

• 2-(Butylsulfanyl)pyrimidine-5-carbaldehyde
• 2-(Butylthio)-5-pyrimidinecarboxaldehyde
• 5-Pyrimidinecarboxaldehyde, 2-(Butylthio)-

2-(Butylthio)pyrimidine-5-carbaldehyde

CAS: 915920-13-7

2-(Butylthio)pyrimidine-5-carbaldehyde

Purity: 95%

Molecular weight: 196.27g/mol

Ref: 54-OR925443

2-(Butylthio)pyrimidine-5-carbaldehyde

CAS: 915920-13-7

2-(Butylthio)pyrimidine-5-carbaldehyde (BTPCA) is a neutralizing agent that inhibits the proliferation of cancer cells by binding to their cell membranes. It binds to the membrane and blocks the cyclic AMP receptor, thereby inhibiting the growth of cells. BTPCA has been shown to be effective in killing CD4+ T cells and may have therapeutic potential for autoimmune diseases. BTPCA also has diagnostic potential, as it can be used to detect epidermal growth factor receptors on cell membranes.

Formula: C₉H₁₂N₂OS

Purity: Min. 95%

Molecular weight: 196.27 g/mol

Ref: 3D-NB57433