CAS 915920-14-8
:N-Cyclopropyl-2-thiazolemethanamine
Description:
N-Cyclopropyl-2-thiazolemethanamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a cyclopropyl group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the cyclopropyl group can influence the compound's steric and electronic properties, potentially enhancing its reactivity and selectivity in chemical reactions. This compound may exhibit properties such as solubility in organic solvents, and its stability can be influenced by environmental factors like temperature and pH. Additionally, N-Cyclopropyl-2-thiazolemethanamine may interact with biological systems, making it of interest in medicinal chemistry for its potential therapeutic applications. However, specific data regarding its toxicity, pharmacokinetics, and detailed reactivity would require further investigation through experimental studies and literature review. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C7H10N2S
InChI:InChI=1S/C7H10N2S/c1-2-6(1)9-5-7-8-3-4-10-7/h3-4,6,9H,1-2,5H2
InChI key:InChIKey=ACDDRSZQTWAHFC-UHFFFAOYSA-N
SMILES:N(CC1=NC=CS1)C2CC2
Synonyms:- N-Cyclopropyl-2-thiazolemethanamine
- 2-Thiazolemethanamine, N-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.