CymitQuimica logo

CAS 915920-22-8

:

3-(Methoxymethyl)-1,2,4-oxadiazole-5-methanamine

Description:
3-(Methoxymethyl)-1,2,4-oxadiazole-5-methanamine, with the CAS number 915920-22-8, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methoxymethyl group and a methanamine substituent, contributing to its unique reactivity and potential applications. The presence of the oxadiazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. Typically, oxadiazoles exhibit properties such as antimicrobial, antifungal, or anticancer activities, depending on their specific structure and substituents. The methoxymethyl and methanamine groups can enhance solubility and bioavailability, which are crucial for therapeutic efficacy. Additionally, the compound's stability, melting point, and solubility in various solvents would be important characteristics to consider for practical applications. Overall, 3-(Methoxymethyl)-1,2,4-oxadiazole-5-methanamine represents a class of compounds with potential utility in pharmaceuticals and agrochemicals.
Formula:C5H9N3O2
InChI:InChI=1S/C5H9N3O2/c1-9-3-4-7-5(2-6)10-8-4/h2-3,6H2,1H3
InChI key:InChIKey=GVMRQEDXKZKKPX-UHFFFAOYSA-N
SMILES:C(OC)C=1N=C(CN)ON1
Synonyms:
  • [3-(Methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine
  • 3-(Methoxymethyl)-1,2,4-oxadiazole-5-methanamine
  • (3-(Methoxymethyl)-1,2,4-oxadiazol-5-yl)methylamine
  • 1,2,4-Oxadiazole-5-methanamine, 3-(methoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.