CAS 915920-25-1

2-(3-methylpiperidin-1-yl)propanoic acid

Description:

2-(3-Methylpiperidin-1-yl)propanoic acid, with the CAS number 915920-25-1, is an organic compound characterized by its piperidine ring structure and a propanoic acid functional group. This compound features a three-carbon chain (propanoic acid) attached to a nitrogen-containing heterocyclic ring (3-methylpiperidine), which contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The piperidine moiety can influence its biological activity, making it of interest in medicinal chemistry. The compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to participate in various chemical reactions, including amide formation and esterification. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₇NO₂

InChI: InChI=1/C9H17NO2/c1-7-4-3-5-10(6-7)8(2)9(11)12/h7-8H,3-6H2,1-2H3,(H,11,12)

SMILES: CC1CCCN(C1)C(C)C(=O)O

Synonyms:

• 1-Piperidineacetic Acid, Α,3-Dimethyl-

2-(3-methylpiperidin-1-yl)propanoic acid

CAS: 915920-25-1

Purity: 95.0%

Color and Shape: Solid, Crystalline

Molecular weight: 171.24000549316406

Ref: 10-F310091