CAS 915920-26-2

N-(2-butyl-6-methyl-pyrimidin-4-yl)ethane-1,2-diamine

Description:

N-(2-butyl-6-methyl-pyrimidin-4-yl)ethane-1,2-diamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a butyl and a methyl group, along with an ethane-1,2-diamine moiety. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as potential basicity due to the presence of amine groups and the ability to participate in hydrogen bonding. Its molecular structure suggests it may have applications in medicinal chemistry, possibly as a pharmaceutical agent or a biochemical probe, owing to the pyrimidine ring's role in biological systems. The presence of the butyl group may enhance lipophilicity, influencing its solubility and permeability in biological membranes. Additionally, the compound's specific interactions with biological targets would depend on its conformation and the spatial arrangement of its functional groups. Overall, N-(2-butyl-6-methyl-pyrimidin-4-yl)ethane-1,2-diamine represents a class of compounds that could be of interest in drug development and research.

Formula: C₁₁H₂₀N₄

InChI: InChI=1/C11H20N4/c1-3-4-5-10-14-9(2)8-11(15-10)13-7-6-12/h8H,3-7,12H2,1-2H3,(H,13,14,15)

SMILES: CCCCc1nc(C)cc(=NCCN)[nH]1

Synonyms:

• 1,2-ethanediamine, N1
• N-(2-butyl-6-methylpyrimidin-4-yl)ethane-1,2-diamine

N-(2-butyl-6-methylpyrimidin-4-yl)ethane-1,2-diamine

CAS: 915920-26-2

Formula: C₁₁H₂₀N₄

Purity: 95.0%

Molecular weight: 208.309

Ref: 10-F310062