CAS 915920-30-8

3-Methyl-N-propylcyclohexanamine

Description:

3-Methyl-N-propylcyclohexanamine is an organic compound characterized by its cyclohexane ring structure, which is substituted with a methyl group and a propylamine side chain. This compound belongs to the class of amines, specifically secondary amines, due to the presence of the nitrogen atom bonded to two carbon-containing groups. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the cyclohexane ring provides a degree of rigidity, while the alkyl substituents can influence its solubility and reactivity. 3-Methyl-N-propylcyclohexanamine may exhibit basic properties typical of amines, allowing it to participate in acid-base reactions. Additionally, its specific stereochemistry can affect its biological activity and interaction with other molecules. As with many organic compounds, safety and handling precautions should be observed, as the compound may have specific toxicity or reactivity profiles that necessitate careful management in laboratory or industrial settings.

Formula: C₁₀H₂₁N

InChI: InChI=1S/C10H21N/c1-3-7-11-10-6-4-5-9(2)8-10/h9-11H,3-8H2,1-2H3

InChI key: InChIKey=XCSDZAOBQAHRBV-UHFFFAOYSA-N

SMILES: N(CCC)C1CC(C)CCC1

Synonyms:

• Cyclohexanamine, 3-methyl-N-propyl-
• 3-Methyl-N-propylcyclohexanamine