CAS 915920-34-2

1-(3-amino-4,5,6-trimethyl-thieno[2,3-b]pyridin-2-yl)ethanone

Description:

1-(3-amino-4,5,6-trimethyl-thieno[2,3-b]pyridin-2-yl)ethanone, with the CAS number 915920-34-2, is a chemical compound characterized by its unique structure that combines a thieno[2,3-b]pyridine moiety with an ethanone functional group. This compound features an amino group, which contributes to its potential as a biological active agent, possibly influencing its solubility and reactivity. The presence of multiple methyl groups enhances its lipophilicity, which may affect its pharmacokinetic properties. The thieno[2,3-b]pyridine framework is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Additionally, the ethanone group suggests potential reactivity in condensation or substitution reactions. Overall, this compound's structural features may lead to diverse applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological properties and potential uses.

Formula: C₁₂H₁₄N₂OS

InChI: InChI=1/C12H14N2OS/c1-5-6(2)9-10(13)11(8(4)15)16-12(9)14-7(5)3/h13H2,1-4H3

SMILES: Cc1c(C)c2c(c(C(=O)C)sc2nc1C)N

1-(3-amino-4,5,6-trimethylthieno[2,3-b]pyridin-2-yl)ethanone

CAS: 915920-34-2

Formula: C₁₂H₁₄N₂OS

Purity: 95.0%

Molecular weight: 234.32

Ref: 10-F314435