CymitQuimica logo

CAS 915920-44-4

:

2-(2-bromophenoxy)-N-methylethanamine

Description:
2-(2-Bromophenoxy)-N-methylethanamine, identified by its CAS number 915920-44-4, is an organic compound characterized by its unique molecular structure, which includes a bromophenyl group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine group. The bromine atom in the bromophenyl moiety can influence the compound's reactivity and polarity, potentially making it a useful intermediate in organic synthesis or pharmaceutical applications. Additionally, the presence of the methylethanamine group suggests that it may participate in hydrogen bonding, affecting its physical properties like boiling and melting points. As with many organic compounds, safety and handling precautions should be observed, as amines can be irritants and may pose health risks. Overall, 2-(2-bromophenoxy)-N-methylethanamine is a compound of interest in various chemical research fields, particularly in medicinal chemistry and materials science.
Formula:C9H12BrNO
InChI:InChI=1/C9H12BrNO/c1-11-6-7-12-9-5-3-2-4-8(9)10/h2-5,11H,6-7H2,1H3
SMILES:CNCCOc1ccccc1Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.