CAS 915920-47-7

2-[5-[1-(benzylamino)cyclohexyl]tetrazol-1-yl]acetic acid

Description:

2-[5-[1-(Benzylamino)cyclohexyl]tetrazol-1-yl]acetic acid, with the CAS number 915920-47-7, is a chemical compound that features a complex structure incorporating a tetrazole ring, an acetic acid moiety, and a benzylamino group attached to a cyclohexyl framework. This compound is characterized by its potential biological activity, particularly in the context of pharmacology, where it may exhibit properties relevant to receptor modulation or enzyme inhibition. The presence of the tetrazole ring contributes to its stability and solubility in various solvents, while the benzylamino group may enhance its interaction with biological targets. Additionally, the cyclohexyl structure can influence the compound's conformational flexibility and lipophilicity, which are important factors in drug design. Overall, this compound's unique structural features suggest it could be of interest in medicinal chemistry, particularly for developing therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₆H₂₁N₅O₂

InChI: InChI=1/C16H21N5O2/c22-14(23)12-21-15(18-19-20-21)16(9-5-2-6-10-16)17-11-13-7-3-1-4-8-13/h1,3-4,7-8,17H,2,5-6,9-12H2,(H,22,23)

SMILES: c1ccc(cc1)CNC1(CCCCC1)c1nnnn1CC(=O)O

{5-[1-(benzylamino)cyclohexyl]-1H-tetrazol-1-yl}acetic acid

CAS: 915920-47-7

Purity: 95.0%

Molecular weight: 315.37701416015625

Ref: 10-F313669