CymitQuimica logo

CAS 915920-48-8

:

4-(propan-2-yloxy)-3-(prop-2-en-1-yl)benzaldehyde

Description:
4-(Propan-2-yloxy)-3-(prop-2-en-1-yl)benzaldehyde, with the CAS number 915920-48-8, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a propan-2-yloxy group and a prop-2-en-1-yl substituent, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The alkenyl group (prop-2-en-1-yl) may also allow for further transformations, including polymerization or cross-coupling reactions. In terms of physical properties, compounds of this nature typically exhibit moderate volatility and may have distinct solubility characteristics depending on the solvent used. The compound's structure suggests potential applications in the fragrance industry, as well as in the synthesis of more complex organic molecules. Overall, 4-(propan-2-yloxy)-3-(prop-2-en-1-yl)benzaldehyde is a versatile compound with interesting chemical properties.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-4-5-12-8-11(9-14)6-7-13(12)15-10(2)3/h4,6-10H,1,5H2,2-3H3
SMILES:C=CCc1cc(ccc1OC(C)C)C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.