CAS 915920-50-2
:5-[(2-Pyrimidinylthio)methyl]-2-furancarboxylic acid
Description:
5-[(2-Pyrimidinylthio)methyl]-2-furancarboxylic acid, with the CAS number 915920-50-2, is a chemical compound characterized by its unique structure that combines a furan ring with a carboxylic acid functional group and a pyrimidine moiety linked via a thioether. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The pyrimidine ring contributes to its potential biological activity, as pyrimidine derivatives are often involved in various pharmacological applications. The thioether linkage may enhance the compound's stability and influence its reactivity. Additionally, the presence of the furan ring can impart interesting electronic properties, making it a candidate for further studies in medicinal chemistry or materials science. Overall, this compound's unique structural features suggest potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.
Formula:C10H8N2O3S
InChI:InChI=1S/C10H8N2O3S/c13-9(14)8-3-2-7(15-8)6-16-10-11-4-1-5-12-10/h1-5H,6H2,(H,13,14)
InChI key:InChIKey=BQGUWPXIDXWYJP-UHFFFAOYSA-N
SMILES:C(SC=1N=CC=CN1)C=2OC(C(O)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[(2-pyrimidinylthio)methyl]-
- 5-[(2-Pyrimidinylthio)methyl]-2-furancarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.