CAS 915920-53-5

2-amino-N,6-dimethyl-4,5,6,7-tetrahydrobenzothiophene-3-carboxamide

Description:

2-amino-N,6-dimethyl-4,5,6,7-tetrahydrobenzothiophene-3-carboxamide is a chemical compound characterized by its unique structure, which includes a benzothiophene core fused with a tetrahydro configuration. This compound features an amino group and a carboxamide functional group, contributing to its potential biological activity. The presence of the dimethyl substituents at the 6-position enhances its steric properties and may influence its interaction with biological targets. The tetrahydrobenzothiophene moiety suggests that the compound may exhibit interesting pharmacological properties, possibly acting as a modulator in various biochemical pathways. Its CAS number, 915920-53-5, allows for easy identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, further studies would be necessary to fully elucidate its biological activity and potential applications.

Formula: C₁₁H₁₆N₂OS

InChI: InChI=1/C11H16N2OS/c1-6-3-4-7-8(5-6)15-10(12)9(7)11(14)13-2/h6H,3-5,12H2,1-2H3,(H,13,14)

SMILES: CC1CCc2c(C1)sc(c2C(=NC)O)N

2-amino-N,6-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide

CAS: 915920-53-5

Formula: C₁₁H₁₆N₂OS

Purity: 95.0%

Molecular weight: 224.32

Ref: 10-F314432