CAS 915920-54-6

3-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde

Description:

3-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde, with the CAS number 915920-54-6, is an organic compound characterized by its benzaldehyde functional group, which is a key feature of aromatic aldehydes. This compound contains a propoxy chain linked to a benzene ring, along with a piperidine moiety that includes a methyl group, contributing to its overall structure and properties. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological effects. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility may vary, typically being soluble in organic solvents while having limited solubility in water due to the hydrophobic nature of the aromatic and aliphatic components. The compound's reactivity can be influenced by the aldehyde group, making it a potential candidate for further chemical modifications or applications in synthesis and drug development.

Formula: C₁₆H₂₃NO₂

InChI: InChI=1S/C16H23NO2/c1-14-5-3-8-17(12-14)9-4-10-19-16-7-2-6-15(11-16)13-18/h2,6-7,11,13-14H,3-5,8-10,12H2,1H3

InChI key: InChIKey=KUVCDVPQSDZEOX-UHFFFAOYSA-N

SMILES: O(CCCN1CC(C)CCC1)C2=CC(C=O)=CC=C2

Synonyms:

• 3-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde
• Benzaldehyde, 3-[3-(3-methyl-1-piperidinyl)propoxy]-