CAS 915920-55-7

4-[2-(2-pyridyl)acetyl]benzoic acid

Description:

4-[2-(2-Pyridyl)acetyl]benzoic acid, with the CAS number 915920-55-7, is an organic compound characterized by its unique structure that combines a benzoic acid moiety with a pyridine-derived acetyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The pyridine ring contributes to its potential for forming hydrogen bonds and participating in various chemical reactions, making it of interest in medicinal chemistry and material science. Its molecular structure suggests it may exhibit biological activity, possibly acting as a ligand or inhibitor in biochemical pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its application and handling. Overall, 4-[2-(2-pyridyl)acetyl]benzoic acid represents a versatile compound with potential applications in pharmaceuticals and research.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1/C14H11NO3/c16-13(9-12-3-1-2-8-15-12)10-4-6-11(7-5-10)14(17)18/h1-8H,9H2,(H,17,18)

SMILES: c1ccnc(c1)CC(=O)c1ccc(cc1)C(=O)O

4-(2-pyridinylacetyl)benzoic acid

CAS: 915920-55-7

Formula: C₁₄H₁₁NO₃

Purity: 95.0%

Molecular weight: 241.246

Ref: 10-F314510