CymitQuimica logo

CAS 915920-58-0

:

2-(2-Bromophenoxy)-N-ethylethanamine

Description:
2-(2-Bromophenoxy)-N-ethylethanamine, with the CAS number 915920-58-0, is a chemical compound characterized by its unique structure, which includes a bromophenyl group and an ethylamine moiety. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and solubility. The presence of the bromine atom may impart specific electronic effects, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the ether linkage (phenoxy group) can contribute to the compound's overall polarity and solubility in organic solvents. As an amine, it may also engage in hydrogen bonding, affecting its physical properties such as boiling and melting points. This compound could be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H14BrNO
InChI:InChI=1S/C10H14BrNO/c1-2-12-7-8-13-10-6-4-3-5-9(10)11/h3-6,12H,2,7-8H2,1H3
InChI key:InChIKey=DFXRVNWDRHERJE-UHFFFAOYSA-N
SMILES:O(CCNCC)C1=C(Br)C=CC=C1
Synonyms:
  • 2-(2-Bromophenoxy)-N-ethylethanamine
  • Ethanamine, 2-(2-bromophenoxy)-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.