CAS 915920-59-1

N-(1-Ethylpropyl)cycloheptanamine

Description:

N-(1-Ethylpropyl)cycloheptanamine is a chemical compound characterized by its unique structure, which includes a cycloheptane ring substituted with an amine group and an ethylpropyl side chain. This compound falls under the category of cyclic amines and is notable for its potential applications in medicinal chemistry and organic synthesis. The presence of the cycloheptane ring contributes to its rigidity and may influence its biological activity and interaction with various receptors. The amine functional group can participate in hydrogen bonding, which may enhance solubility in polar solvents and affect its pharmacokinetic properties. Additionally, the branched alkyl chain can impact the compound's lipophilicity, potentially influencing its ability to cross biological membranes. As with many amines, N-(1-Ethylpropyl)cycloheptanamine may exhibit basic properties, allowing it to form salts with acids. Overall, the specific characteristics of this compound, including its reactivity and stability, would depend on its molecular structure and the surrounding environmental conditions.

Formula: C₁₂H₂₅N

InChI: InChI=1S/C12H25N/c1-3-11(4-2)13-12-9-7-5-6-8-10-12/h11-13H,3-10H2,1-2H3

InChI key: InChIKey=GBRBSIOOKRVTQD-UHFFFAOYSA-N

SMILES: N(C(CC)CC)C1CCCCCC1

Synonyms:

• N-(1-Ethylpropyl)cycloheptanamine
• Cycloheptanamine, N-(1-ethylpropyl)-