CAS 915920-60-4
:2-(3-bromophenoxy)-N-ethylethanamine
Description:
2-(3-Bromophenoxy)-N-ethylethanamine is an organic compound characterized by its unique structure, which includes a bromophenyl group and an ethylamine moiety. The presence of the bromine atom on the phenoxy ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (the bromophenyl group) and hydrophilic (the amine group) components. It may participate in hydrogen bonding due to the amine functionality, influencing its solubility in various solvents. The compound's potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit interesting pharmacological properties. Additionally, the bromine substituent can enhance the compound's lipophilicity, affecting its distribution and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C10H14BrNO
InChI:InChI=1/C10H14BrNO/c1-2-12-6-7-13-10-5-3-4-9(11)8-10/h3-5,8,12H,2,6-7H2,1H3
SMILES:CCNCCOc1cccc(c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.