CymitQuimica logo

CAS 915920-61-5

:

N-(1-Ethylpropyl)-2-fluorobenzenemethanamine

Description:
N-(1-Ethylpropyl)-2-fluorobenzenemethanamine, with the CAS number 915920-61-5, is a chemical compound that belongs to the class of substituted amines. This substance features a fluorobenzene ring, which contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the ethylpropyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The fluorine atom in the para position can affect the electronic properties of the aromatic ring, potentially enhancing the compound's stability and reactivity. As with many amines, it may exhibit basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Safety and handling precautions are essential due to the potential for toxicity and environmental impact. Overall, this compound's structural features suggest it may have interesting biological activities, warranting further investigation in medicinal chemistry and related disciplines.
Formula:C12H18FN
InChI:InChI=1S/C12H18FN/c1-3-11(4-2)14-9-10-7-5-6-8-12(10)13/h5-8,11,14H,3-4,9H2,1-2H3
InChI key:InChIKey=YQSUZVDNYDHSBF-UHFFFAOYSA-N
SMILES:C(NC(CC)CC)C1=C(F)C=CC=C1
Synonyms:
  • Benzenemethanamine, N-(1-ethylpropyl)-2-fluoro-
  • N-(1-Ethylpropyl)-2-fluorobenzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.