CymitQuimica logo

CAS 915920-67-1

:

3-ethoxy-5-prop-2-en-1-yl-4-(prop-2-en-1-yloxy)benzaldehyde

Description:
3-Ethoxy-5-prop-2-en-1-yl-4-(prop-2-en-1-yloxy)benzaldehyde is an organic compound characterized by its complex structure, which includes an aromatic ring with multiple substituents. The presence of an ethoxy group and two prop-2-en-1-yl groups indicates that it has both ether and aldehyde functional groups, contributing to its reactivity and potential applications in organic synthesis. The compound's structure suggests it may exhibit properties typical of both aldehydes and alkenes, such as reactivity in nucleophilic addition and potential for polymerization due to the presence of the alkene functionalities. Additionally, the compound may possess interesting optical properties due to the conjugated system formed by the aromatic ring and the alkenes. Its CAS number, 915920-67-1, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry, materials science, and organic synthesis. Overall, this compound's unique structure may lead to diverse applications, particularly in the development of new materials or pharmaceuticals.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-4-7-13-9-12(11-16)10-14(17-6-3)15(13)18-8-5-2/h4-5,9-11H,1-2,6-8H2,3H3
SMILES:C=CCc1cc(cc(c1OCC=C)OCC)C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.