CymitQuimica logo

CAS 915920-69-3

:

3-Chloro-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)propanamide

Description:
3-Chloro-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)propanamide, with the CAS number 915920-69-3, is a chemical compound characterized by its unique structural features, including a chloro substituent and a benzimidazole moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The benzimidazole ring contributes to its biological activity, often making it a subject of interest in medicinal chemistry for its potential pharmacological properties. The chloro group may influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the dihydro-2-oxo structure suggests potential for tautomeric forms, which can affect its stability and reactivity. Overall, this compound's characteristics make it a valuable candidate for further research in drug development and chemical synthesis.
Formula:C10H10ClN3O2
InChI:InChI=1S/C10H10ClN3O2/c11-4-3-9(15)12-6-1-2-7-8(5-6)14-10(16)13-7/h1-2,5H,3-4H2,(H,12,15)(H2,13,14,16)
InChI key:InChIKey=JGCKERWIFJNBBQ-UHFFFAOYSA-N
SMILES:N(C(CCCl)=O)C=1C=C2C(=CC1)NC(=O)N2
Synonyms:
  • Propanamide, 3-chloro-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-
  • 3-Chloro-N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.