CAS 915920-70-6
:(3-sec-butoxyphenyl)methanol
Description:
(3-sec-Butoxyphenyl)methanol is an organic compound characterized by its phenolic structure, which features a methanol group attached to a phenyl ring that has a sec-butoxy substituent at the meta position. This compound typically exhibits properties associated with both alcohols and ethers due to the presence of the hydroxyl (-OH) group and the ether-like sec-butoxy group. It is likely to be a colorless to pale yellow liquid with moderate solubility in organic solvents and limited solubility in water, reflecting the hydrophobic nature of the butoxy group. The compound may participate in hydrogen bonding due to the hydroxyl group, influencing its boiling point and reactivity. Its potential applications could span various fields, including pharmaceuticals and materials science, where it may serve as an intermediate or a functional additive. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16O2
InChI:InChI=1/C11H16O2/c1-3-9(2)13-11-6-4-5-10(7-11)8-12/h4-7,9,12H,3,8H2,1-2H3
SMILES:CCC(C)Oc1cccc(c1)CO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.