CAS 915920-72-8

3-(4-Ethylphenoxy)-N-methyl-1-propanamine

Description:

3-(4-Ethylphenoxy)-N-methyl-1-propanamine is an organic compound characterized by its amine functional group and ether linkage. It features a propanamine backbone, which is substituted with a 4-ethylphenoxy group, contributing to its hydrophobic characteristics. The presence of the ethyl group on the phenyl ring enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The N-methyl group adds steric bulk, which can affect the compound's interaction with biological targets, such as receptors or enzymes. This compound may exhibit properties typical of amines, including basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions in various chemical environments. Its specific applications and biological effects would depend on its structural characteristics and the context in which it is used, such as in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₉NO

InChI: InChI=1S/C12H19NO/c1-3-11-5-7-12(8-6-11)14-10-4-9-13-2/h5-8,13H,3-4,9-10H2,1-2H3

InChI key: InChIKey=OWJQTSTVRNGVKH-UHFFFAOYSA-N

SMILES: O(CCCNC)C1=CC=C(CC)C=C1

Synonyms:

• 3-(4-Ethylphenoxy)-N-methyl-1-propanamine
• 1-Propanamine, 3-(4-ethylphenoxy)-N-methyl-