CAS 915920-74-0
:5-Ethyl-N-methyl-1,3,4-oxadiazole-2-methanamine
Description:
5-Ethyl-N-methyl-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of an ethyl group and a methylamine substituent enhances its solubility and reactivity. This compound is likely to exhibit properties typical of oxadiazoles, such as antimicrobial or antifungal activities, due to the electron-withdrawing nature of the oxadiazole moiety. Its molecular structure suggests it may participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the presence of nitrogen atoms in the oxadiazole ring and the amine group may contribute to its basicity and potential as a ligand in coordination chemistry. The compound's CAS number, 915920-74-0, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, 5-Ethyl-N-methyl-1,3,4-oxadiazole-2-methanamine represents a class of compounds with diverse applications, warranting further investigation into its properties and potential uses.
Formula:C6H11N3O
InChI:InChI=1S/C6H11N3O/c1-3-5-8-9-6(10-5)4-7-2/h7H,3-4H2,1-2H3
InChI key:InChIKey=SSJSEXJMZZHGLB-UHFFFAOYSA-N
SMILES:C(NC)C=1OC(CC)=NN1
Synonyms:- 1,3,4-Oxadiazole-2-methanamine, 5-ethyl-N-methyl-
- 5-Ethyl-N-methyl-1,3,4-oxadiazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
