CAS 915920-78-4

5-[2-(3,5-dimethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine

Description:

5-[2-(3,5-Dimethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. This compound features a phenoxyethyl side chain, which contributes to its potential biological activity. Thiadiazoles are known for their diverse pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities. The presence of the dimethylphenyl group may enhance lipophilicity, potentially influencing the compound's bioavailability and interaction with biological targets. The amine group can participate in hydrogen bonding, which is crucial for molecular interactions in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the thiadiazole ring. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-8-5-9(2)7-10(6-8)16-4-3-11-14-15-12(13)17-11/h5-7H,3-4H2,1-2H3,(H2,13,15)

SMILES: Cc1cc(C)cc(c1)OCCc1n[nH]c(=N)s1

5-[2-(3,5-dimethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine

CAS: 915920-78-4

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F316055