CAS 915920-84-2
:(4-fluorophenyl)-(1H-imidazol-2-yl)methanone
Description:
(4-Fluorophenyl)-(1H-imidazol-2-yl)methanone, with the CAS number 915920-84-2, is a chemical compound characterized by its unique structural features. It consists of a fluorinated phenyl group attached to an imidazole ring, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. The imidazole moiety is known for its role in various biological systems and can participate in hydrogen bonding and coordination with metal ions. This compound may exhibit properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its structural characteristics. Additionally, the presence of the carbonyl group (methanone) contributes to its reactivity, making it a candidate for further chemical transformations. Overall, the combination of these functional groups suggests that this compound may have interesting pharmacological properties worth exploring in medicinal chemistry.
Formula:C10H7FN2O
InChI:InChI=1/C10H7FN2O/c11-8-3-1-7(2-4-8)9(14)10-12-5-6-13-10/h1-6H,(H,12,13)
SMILES:c1cc(ccc1C(=O)c1ncc[nH]1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
