CAS 915920-97-7

5-[(1H-1,2,4-Triazol-5-ylthio)methyl]-2-furancarboxylic acid

Description:

5-[(1H-1,2,4-Triazol-5-ylthio)methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structural features, which include a furan ring and a triazole moiety. The presence of the furan ring contributes to its aromatic properties, while the carboxylic acid functional group provides acidic characteristics, making it potentially useful in various chemical reactions. The triazole group, known for its stability and ability to form coordination complexes, may enhance the compound's biological activity and interaction with metal ions. This compound is likely to exhibit solubility in polar solvents due to the presence of the carboxylic acid group, while the furan and triazole rings may impart some degree of hydrophobicity. Its potential applications could span across pharmaceuticals, agrochemicals, and materials science, particularly in the development of biologically active compounds or as intermediates in synthetic pathways. Overall, the combination of these functional groups suggests a versatile compound with interesting chemical reactivity and potential utility in various fields.

Formula: C₈H₇N₃O₃S

InChI: InChI=1S/C8H7N3O3S/c12-7(13)6-2-1-5(14-6)3-15-8-9-4-10-11-8/h1-2,4H,3H2,(H,12,13)(H,9,10,11)

InChI key: InChIKey=GNWPFJRHXNYZJV-UHFFFAOYSA-N

SMILES: C(SC=1NC=NN1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(1H-1,2,4-triazol-5-ylthio)methyl]-
• 5-[(1H-1,2,4-Triazol-5-ylthio)methyl]-2-furancarboxylic acid
• 5-[(1H-1,2,4-triazol-5-ylthio)methyl]-2-furoic acid

5-[(4H-1,2,4-triazol-3-ylthio)methyl]-2-furoic acid

CAS: 915920-97-7

Formula: C₈H₇N₃O₃S

Purity: 95.0%

Molecular weight: 225.22

Ref: 10-F315638