CAS 915921-01-6

N-allyl-6-chloro-pyridine-3-carboxamide

Description:

N-allyl-6-chloro-pyridine-3-carboxamide is a chemical compound characterized by its pyridine ring structure, which includes a chlorine substituent at the 6-position and an allyl group attached to the nitrogen atom of the amide functional group. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the electrophilic chlorine atom and the nucleophilic amide group. The allyl group may impart additional reactivity, allowing for various chemical transformations. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. The presence of the chlorine atom can also influence the compound's lipophilicity and biological interactions. As with many chemical substances, safety data and handling precautions should be considered, as the compound may exhibit toxicity or other hazardous properties.

Formula: C₉H₉ClN₂O

InChI: InChI=1/C9H9ClN2O/c1-2-5-11-9(13)7-3-4-8(10)12-6-7/h2-4,6H,1,5H2,(H,11,13)

InChI key: InChIKey=DQCBAARVIMURGR-UHFFFAOYSA-N

SMILES: C=CCN=C(c1ccc(Cl)nc1)O

6-Chloro-N-(prop-2-en-1-yl)pyridine-3-carboxamide

CAS: 915921-01-6

Versatile small molecule scaffold

Formula: C₉H₉ClN₂O

Purity: Min. 95%

Molecular weight: 196.63 g/mol

Ref: 3D-QLB92101