CAS 915921-04-9
:3-[(cyclobutylcarbonyl)amino]-4-methylbenzoic acid
Description:
3-[(Cyclobutylcarbonyl)amino]-4-methylbenzoic acid, identified by its CAS number 915921-04-9, is a chemical compound characterized by its unique structure that includes a benzoic acid moiety substituted with an amino group and a cyclobutylcarbonyl group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming salts or esters. The presence of the cyclobutyl group introduces a cyclic aliphatic structure, which can influence the compound's steric properties and reactivity. The methyl group at the para position relative to the amino group can affect the electronic distribution within the molecule, potentially impacting its interactions with biological targets or other chemical species. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry or related fields. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.
Formula:C13H15NO3
InChI:InChI=1/C13H15NO3/c1-8-5-6-10(13(16)17)7-11(8)14-12(15)9-3-2-4-9/h5-7,9H,2-4H2,1H3,(H,14,15)(H,16,17)
SMILES:Cc1ccc(cc1N=C(C1CCC1)O)C(=O)O
Synonyms:- Benzoic Acid, 3-[(Cyclobutylcarbonyl)Amino]-4-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.