CymitQuimica logo

CAS 915921-08-3

:

3-(5-chloro-1H-benzimidazol-2-yl)propan-1-amine

Description:
3-(5-chloro-1H-benzimidazol-2-yl)propan-1-amine is a chemical compound characterized by its structural features, which include a benzimidazole ring substituted with a chlorine atom and an amine group attached to a propyl chain. The presence of the chlorine atom enhances its biological activity and solubility properties. This compound typically exhibits a moderate to high polarity due to the amine functional group, which can participate in hydrogen bonding. It may also display significant pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The benzimidazole moiety is known for its role in various biological activities, including antimicrobial and anticancer effects. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituent and the amine group. Overall, 3-(5-chloro-1H-benzimidazol-2-yl)propan-1-amine is a versatile compound with potential applications in drug discovery and development.
Formula:C10H12ClN3
InChI:InChI=1/C10H12ClN3/c11-7-3-4-8-9(6-7)14-10(13-8)2-1-5-12/h3-4,6H,1-2,5,12H2,(H,13,14)
SMILES:C(Cc1nc2ccc(cc2[nH]1)Cl)CN
Synonyms:
  • 1H-benzimidazole-2-propanamine, 5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.