CAS 915921-10-7

2-(2-aminoethyl)-4-methyl-thiazole-5-carboxylic acid

Description:

2-(2-Aminoethyl)-4-methyl-thiazole-5-carboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an aminoethyl side chain, contributing to its potential as a building block in pharmaceuticals or biochemistry. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in water. The methyl group at the 4-position of the thiazole ring can influence its steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for the development of therapeutic agents. Additionally, its CAS number, 915921-10-7, allows for easy identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature.

Formula: C₇H₁₀N₂O₂S

InChI: InChI=1/C7H10N2O2S/c1-4-6(7(10)11)12-5(9-4)2-3-8/h2-3,8H2,1H3,(H,10,11)

SMILES: Cc1c(C(=O)O)sc(CCN)n1

2-(2-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid

CAS: 915921-10-7

Formula: C₇H₁₀N₂O₂S

Purity: 95.0%

Molecular weight: 186.23

Ref: 10-F308815