CAS 915921-16-3
:2-(6,7-dimethyl-2-oxo-indolin-3-yl)acetic acid
Description:
2-(6,7-dimethyl-2-oxo-indolin-3-yl)acetic acid is an organic compound characterized by its indole-derived structure, which features a 2-oxo-indoline moiety substituted with a 2-acetic acid group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the dimethyl groups contributes to its hydrophobic character, which can influence its solubility and interaction with biological systems. The carboxylic acid functional group imparts acidic properties, allowing for potential reactivity in esterification or amidation reactions. Additionally, the indoline structure may exhibit interesting biological activities, such as anti-inflammatory or anticancer properties, which are common in compounds derived from indole scaffolds. Overall, 2-(6,7-dimethyl-2-oxo-indolin-3-yl)acetic acid represents a unique chemical entity with potential applications in pharmaceuticals and organic synthesis, warranting further investigation into its properties and biological effects.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c1-6-3-4-8-9(5-10(14)15)12(16)13-11(8)7(6)2/h3-4,9H,5H2,1-2H3,(H,13,16)(H,14,15)
SMILES:Cc1ccc2C(CC(=O)O)C(=Nc2c1C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.