CAS 915921-19-6

6,7-Dimethyl-1H-benzimidazole-2-propanoic acid

Description:

6,7-Dimethyl-1H-benzimidazole-2-propanoic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two methyl groups at the 6 and 7 positions and a propanoic acid functional group at the 2 position. This compound is typically classified as an organic acid due to the presence of the carboxylic acid group (-COOH), which imparts acidic properties. The benzimidazole moiety contributes to its potential biological activity, as compounds in this class are often investigated for their pharmacological properties, including antimicrobial and anti-inflammatory effects. The presence of methyl groups can influence the compound's solubility, stability, and reactivity. Additionally, the specific arrangement of atoms and functional groups can affect its interaction with biological targets, making it of interest in medicinal chemistry. Overall, 6,7-Dimethyl-1H-benzimidazole-2-propanoic acid represents a compound with potential applications in pharmaceuticals and biochemistry, warranting further study to elucidate its properties and effects.

Formula: C₁₂H₁₄N₂O₂

InChI: InChI=1S/C12H14N2O2/c1-7-3-4-9-12(8(7)2)14-10(13-9)5-6-11(15)16/h3-4H,5-6H2,1-2H3,(H,13,14)(H,15,16)

InChI key: InChIKey=OIBSOTVYJCHRGX-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(CCC(O)=O)N2)=CC=C1C

Synonyms:

• 1H-Benzimidazole-2-propanoic acid, 6,7-dimethyl-
• 6,7-Dimethyl-1H-benzimidazole-2-propanoic acid