CymitQuimica logo

CAS 915921-22-1

:

3-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine

Description:
3-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine, with the CAS number 915921-22-1, is a chemical compound characterized by its complex structure, which includes an oxadiazole ring and an aniline moiety. The presence of the 4-methylphenyl group contributes to its aromatic characteristics, enhancing its stability and potential reactivity. This compound is likely to exhibit properties typical of aromatic amines, such as being a potential candidate for various chemical reactions, including electrophilic substitutions. The oxadiazole ring may impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Its potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with many organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with aromatic amines.
Formula:C15H13N3O
InChI:InChI=1S/C15H13N3O/c1-10-5-7-11(8-6-10)14-17-15(19-18-14)12-3-2-4-13(16)9-12/h2-9H,16H2,1H3
InChI key:InChIKey=LPWJAGIYFFVSPY-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=2N=C(ON2)C3=CC(N)=CC=C3)C=C1
Synonyms:
  • 3-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]benzenamine
  • Benzenamine, 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.