CymitQuimica logo

CAS 915921-30-1

:

3-Chloro-2-(3-methyl-1-piperidinyl)benzenamine

Description:
3-Chloro-2-(3-methyl-1-piperidinyl)benzenamine, with the CAS number 915921-30-1, is an organic compound characterized by its aromatic amine structure. It features a chlorobenzene ring substituted at the second position with a piperidine derivative, specifically a 3-methyl-1-piperidinyl group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorine atom introduces additional reactivity, potentially allowing for electrophilic substitution reactions. The piperidine ring contributes to the compound's overall steric and electronic properties, which may affect its biological activity and interactions with other molecules. As with many amines, it may also be sensitive to oxidation and can participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed due to potential toxicity associated with amines and halogenated compounds.
Formula:C12H17ClN2
InChI:InChI=1S/C12H17ClN2/c1-9-4-3-7-15(8-9)12-10(13)5-2-6-11(12)14/h2,5-6,9H,3-4,7-8,14H2,1H3
InChI key:InChIKey=NKWBFZYHOQYFCC-UHFFFAOYSA-N
SMILES:ClC1=C(N2CC(C)CCC2)C(N)=CC=C1
Synonyms:
  • Benzenamine, 3-chloro-2-(3-methyl-1-piperidinyl)-
  • 3-Chloro-2-(3-methyl-1-piperidinyl)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.