CymitQuimica logo

CAS 915921-37-8

:

2-[3-(aminomethyl)piperidin-1-yl]ethanol

Description:
2-[3-(Aminomethyl)piperidin-1-yl]ethanol, with the CAS number 915921-37-8, is a chemical compound characterized by its structure, which includes a piperidine ring substituted with an aminomethyl group and an ethanol moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of hydroxyl (-OH) and amine (-NH2) functional groups. The compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Its potential applications could span across pharmaceuticals, where it may serve as an intermediate or active ingredient in drug development, particularly in the synthesis of compounds targeting neurological or psychiatric conditions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H18N2O
InChI:InChI=1/C8H18N2O/c9-6-8-2-1-3-10(7-8)4-5-11/h8,11H,1-7,9H2
SMILES:C1CC(CN)CN(C1)CCO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.