CAS 915921-44-7

2-(2-chloro-4-methyl-phenoxy)-N-methyl-ethanamine

Description:

2-(2-chloro-4-methyl-phenoxy)-N-methyl-ethanamine, with the CAS number 915921-44-7, is a chemical compound characterized by its unique structure, which includes a phenoxy group substituted with a chlorine atom and a methyl group on the aromatic ring, as well as a N-methyl-ethanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chloro and methyl substituents on the phenyl ring can affect its reactivity and interaction with biological systems, potentially making it of interest in pharmaceutical applications. Additionally, the compound may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₀H₁₄ClNO

InChI: InChI=1/C10H14ClNO/c1-8-3-4-10(9(11)7-8)13-6-5-12-2/h3-4,7,12H,5-6H2,1-2H3

SMILES: Cc1ccc(c(c1)Cl)OCCNC

2-(2-chloro-4-methylphenoxy)-N-methylethanamine

CAS: 915921-44-7

Formula: C₁₀H₁₄ClNO

Purity: 95.0%

Molecular weight: 199.68

Ref: 10-F315944