CymitQuimica logo

CAS 915921-45-8

:

N-Ethyl-6-fluoro-1H-benzimidazole-2-ethanamine

Description:
N-Ethyl-6-fluoro-1H-benzimidazole-2-ethanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with an ethyl group and a fluorine atom. The presence of the fluorine atom at the 6-position of the benzimidazole ring enhances its biological activity and lipophilicity, potentially influencing its pharmacological properties. The ethyl group attached to the amine functional group contributes to the compound's overall hydrophobic character. This compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug discovery processes. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific functional groups present, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C11H14FN3
InChI:InChI=1S/C11H14FN3/c1-2-13-6-5-11-14-9-4-3-8(12)7-10(9)15-11/h3-4,7,13H,2,5-6H2,1H3,(H,14,15)
InChI key:InChIKey=WJQCOAYHCQSXPZ-UHFFFAOYSA-N
SMILES:C(CNCC)C=1NC=2C(N1)=CC=C(F)C2
Synonyms:
  • N-Ethyl-6-fluoro-1H-benzimidazole-2-ethanamine
  • 1H-Benzimidazole-2-ethanamine, N-ethyl-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.